C12H10BrClFN3 — CID 115399287
3-(bromomethyl)-5-(2-chloro-3-fluorophenyl)-4-cyclopropyl-1,2,4-triazole (PubChem CID 115399287) has the molecular formula C12H10BrClFN3 and a molecular weight of 330.59 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(2-chloro-3-fluorophenyl)-4-cyclopropyl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(2-chloro-3-fluorophenyl)-4-cyclopropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115399287 |
| Molecular Formula | C12H10BrClFN3 |
| Molecular Weight | 330.59 g/mol |
| Exact Mass | 328.97 |
| IUPAC Name | 3-(bromomethyl)-5-(2-chloro-3-fluorophenyl)-4-cyclopropyl-1,2,4-triazole |
| SMILES | Fc1cccc(-c2nnc(CBr)n2C2CC2)c1Cl |
| InChI | InChI=1S/C12H10BrClFN3/c13-6-10-16-17-12(18(10)7-4-5-7)8-2-1-3-9(15)11(8)14/h1-3,7H,4-6H2 |
| InChIKey | UDNZTRYUHFVQCT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|