C14H17Br2N3 — CID 115399425
3-(bromomethyl)-5-(3-bromo-2-methylphenyl)-4-tert-butyl-1,2,4-triazole (PubChem CID 115399425) has the molecular formula C14H17Br2N3 and a molecular weight of 387.12 g/mol. Its IUPAC name is 3-(bromomethyl)-5-(3-bromo-2-methylphenyl)-4-tert-butyl-1,2,4-triazole.
| Compound Name | 3-(bromomethyl)-5-(3-bromo-2-methylphenyl)-4-tert-butyl-1,2,4-triazole |
|---|---|
| PubChem CID | 115399425 |
| Molecular Formula | C14H17Br2N3 |
| Molecular Weight | 387.12 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 3-(bromomethyl)-5-(3-bromo-2-methylphenyl)-4-tert-butyl-1,2,4-triazole |
| SMILES | Cc1c(Br)cccc1-c1nnc(CBr)n1C(C)(C)C |
| InChI | InChI=1S/C14H17Br2N3/c1-9-10(6-5-7-11(9)16)13-18-17-12(8-15)19(13)14(2,3)4/h5-7H,8H2,1-4H3 |
| InChIKey | YFUODOKAAFIHOP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.12 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|