C13H23N — CID 115400230
(1R,4S)-1,3,3-trimethyl-N-prop-2-enylbicyclo[2.2.1]heptan-2-amine (PubChem CID 115400230) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is (1R,4S)-1,3,3-trimethyl-N-prop-2-enylbicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,4S)-1,3,3-trimethyl-N-prop-2-enylbicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 115400230 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | (1R,4S)-1,3,3-trimethyl-N-prop-2-enylbicyclo[2.2.1]heptan-2-amine |
| SMILES | C=CCNC1C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C13H23N/c1-5-8-14-11-12(2,3)10-6-7-13(11,4)9-10/h5,10-11,14H,1,6-9H2,2-4H3/t10-,11?,13+/m0/s1 |
| InChIKey | YOGPEKFOHSPZSE-CCQDYZPNSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|