C18H27BrN2 — CID 115400614
4-bromo-1-N,1-N-dimethyl-2-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diamine (PubChem CID 115400614) has the molecular formula C18H27BrN2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 4-bromo-1-N,1-N-dimethyl-2-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diamine.
| Compound Name | 4-bromo-1-N,1-N-dimethyl-2-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115400614 |
| Molecular Formula | C18H27BrN2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-bromo-1-N,1-N-dimethyl-2-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]benzene-1,2-diamine |
| SMILES | CN(C)c1ccc(Br)cc1NC1C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C18H27BrN2/c1-17(2)12-8-9-18(3,11-12)16(17)20-14-10-13(19)6-7-15(14)21(4)5/h6-7,10,12,16,20H,8-9,11H2,1-5H3/t12-,16?,18+/m0/s1 |
| InChIKey | WKHBGYXNTRSDMQ-GPYKOTTCSA-N |
| XLogP | 5.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |