C23H26FN5O5 — CID 11540072
N-(7-fluoro-3-methoxyquinoxalin-2-yl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide (PubChem CID 11540072) has the molecular formula C23H26FN5O5 and a molecular weight of 471.49 g/mol. Its IUPAC name is N-(7-fluoro-3-methoxyquinoxalin-2-yl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-(7-fluoro-3-methoxyquinoxalin-2-yl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 11540072 |
| Molecular Formula | C23H26FN5O5 |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-(7-fluoro-3-methoxyquinoxalin-2-yl)-4-(3,4,5-trimethoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1cc(N2CCN(C(=O)Nc3nc4cc(F)ccc4nc3OC)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26FN5O5/c1-31-18-12-15(13-19(32-2)20(18)33-3)28-7-9-29(10-8-28)23(30)27-21-22(34-4)26-16-6-5-14(24)11-17(16)25-21/h5-6,11-13H,7-10H2,1-4H3,(H,25,27,30) |
| InChIKey | GJGGTBGJSAIRKQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|