C16H23ClN2 — CID 115400860
2-chloro-4-methyl-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridin-3-amine (PubChem CID 115400860) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridin-3-amine.
| Compound Name | 2-chloro-4-methyl-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridin-3-amine |
|---|---|
| PubChem CID | 115400860 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-chloro-4-methyl-N-[(1R,4S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]pyridin-3-amine |
| SMILES | Cc1ccnc(Cl)c1NC1C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C16H23ClN2/c1-10-6-8-18-13(17)12(10)19-14-15(2,3)11-5-7-16(14,4)9-11/h6,8,11,14,19H,5,7,9H2,1-4H3/t11-,14?,16+/m0/s1 |
| InChIKey | YITUMKYRNYNHIQ-ZIHDAQAOSA-N |
| XLogP | 4.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|