C28H46O4Si — CID 11540137
(1S,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-9-prop-2-enyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-6,9-diol (PubChem CID 11540137) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is (1S,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-9-prop-2-enyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-6,9-diol.
| Compound Name | (1S,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-9-prop-2-enyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-6,9-diol |
|---|---|
| PubChem CID | 11540137 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (1S,2S,5aS,9S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-8,9a-dimethyl-1-prop-1-en-2-yl-9-prop-2-enyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalene-6,9-diol |
| SMILES | C=CC[C@]1(O)C(C)=CC(O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3C[C@H](OC)[C@H](C(=C)C)[C@H]3[C@]21C |
| InChI | InChI=1S/C28H46O4Si/c1-12-13-28(30)18(4)14-21(29)20-16-22(32-33(10,11)26(5,6)7)19-15-23(31-9)24(17(2)3)25(19)27(20,28)8/h12,14,20-21,23-25,29-30H,1-2,13,15-16H2,3-11H3/t20-,21?,23+,24+,25+,27+,28+/m1/s1 |
| InChIKey | HRDUZYLRSOVLKI-WIOXJZNASA-N |
| XLogP | 6.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|