C29H25N5O2 — CID 11540154
3-[5-[(2R)-2-amino-1-phenylpropan-2-yl]-1,3,4-oxadiazol-2-yl]-5-(2-cyanophenyl)-N-methyl-N-prop-2-ynylbenzamide (PubChem CID 11540154) has the molecular formula C29H25N5O2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[5-[(2R)-2-amino-1-phenylpropan-2-yl]-1,3,4-oxadiazol-2-yl]-5-(2-cyanophenyl)-N-methyl-N-prop-2-ynylbenzamide.
| Compound Name | 3-[5-[(2R)-2-amino-1-phenylpropan-2-yl]-1,3,4-oxadiazol-2-yl]-5-(2-cyanophenyl)-N-methyl-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 11540154 |
| Molecular Formula | C29H25N5O2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 3-[5-[(2R)-2-amino-1-phenylpropan-2-yl]-1,3,4-oxadiazol-2-yl]-5-(2-cyanophenyl)-N-methyl-N-prop-2-ynylbenzamide |
| SMILES | C#CCN(C)C(=O)c1cc(-c2nnc([C@](C)(N)Cc3ccccc3)o2)cc(-c2ccccc2C#N)c1 |
| InChI | InChI=1S/C29H25N5O2/c1-4-14-34(3)27(35)24-16-22(25-13-9-8-12-21(25)19-30)15-23(17-24)26-32-33-28(36-26)29(2,31)18-20-10-6-5-7-11-20/h1,5-13,15-17H,14,18,31H2,2-3H3/t29-/m1/s1 |
| InChIKey | RGJKFYFSEOAOIA-GDLZYMKVSA-N |
| XLogP | 4.40 |
| TPSA | 109.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|