C13H25Cl3N10O3 — CID 11540165
3,5-diamino-6-chloro-N-[N'-[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]ethyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride (PubChem CID 11540165) has the molecular formula C13H25Cl3N10O3 and a molecular weight of 475.77 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]ethyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]ethyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 11540165 |
| Molecular Formula | C13H25Cl3N10O3 |
| Molecular Weight | 475.77 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[2-[2-[2-(diaminomethylideneamino)ethoxy]ethoxy]ethyl]carbamimidoyl]pyrazine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=NCCOCCOCC/N=C(\N)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C13H23ClN10O3.2ClH/c14-8-10(16)23-9(15)7(22-8)11(25)24-13(19)21-2-4-27-6-5-26-3-1-20-12(17)18;;/h1-6H2,(H4,15,16,23)(H4,17,18,20)(H3,19,21,24,25);2*1H |
| InChIKey | FUNNAYQAKLWZIT-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 228.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.77 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|