C27H30ClN5O — CID 11540170
2-chloro-4-[2-[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]ethoxy]aniline (PubChem CID 11540170) has the molecular formula C27H30ClN5O and a molecular weight of 476.02 g/mol. Its IUPAC name is 2-chloro-4-[2-[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]ethoxy]aniline.
| Compound Name | 2-chloro-4-[2-[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]ethoxy]aniline |
|---|---|
| PubChem CID | 11540170 |
| Molecular Formula | C27H30ClN5O |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 2-chloro-4-[2-[4-[2-(4-ethylphenyl)-1H-benzimidazol-4-yl]piperazin-1-yl]ethoxy]aniline |
| SMILES | CCc1ccc(-c2nc3c(N4CCN(CCOc5ccc(N)c(Cl)c5)CC4)cccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H30ClN5O/c1-2-19-6-8-20(9-7-19)27-30-24-4-3-5-25(26(24)31-27)33-14-12-32(13-15-33)16-17-34-21-10-11-23(29)22(28)18-21/h3-11,18H,2,12-17,29H2,1H3,(H,30,31) |
| InChIKey | KIUGPZSVKMESRZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|