C30H40FN3O — CID 11540207
7-cyclohexyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 11540207) has the molecular formula C30H40FN3O and a molecular weight of 477.67 g/mol. Its IUPAC name is 7-cyclohexyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 7-cyclohexyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 11540207 |
| Molecular Formula | C30H40FN3O |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 7-cyclohexyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CC12CCC(C1)C(C)(C)C2NC(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2C1CCCCC1 |
| InChI | InChI=1S/C30H40FN3O/c1-29(2)20-16-17-30(3,18-20)28(29)32-27(35)25-24-11-7-10-23(19-8-5-4-6-9-19)26(24)34(33-25)22-14-12-21(31)13-15-22/h12-15,19-20,23,28H,4-11,16-18H2,1-3H3,(H,32,35) |
| InChIKey | RRXQJQNRJMQDIX-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |