C26H32BrN3O — CID 11540283
6-bromo-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3,4,9-tetrahydro-1H-carbazole (PubChem CID 11540283) has the molecular formula C26H32BrN3O and a molecular weight of 482.47 g/mol. Its IUPAC name is 6-bromo-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3,4,9-tetrahydro-1H-carbazole.
| Compound Name | 6-bromo-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3,4,9-tetrahydro-1H-carbazole |
|---|---|
| PubChem CID | 11540283 |
| Molecular Formula | C26H32BrN3O |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 6-bromo-1-[4-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3,4,9-tetrahydro-1H-carbazole |
| SMILES | CN1CCN(CCCOc2ccc(C3CCCc4c3[nH]c3ccc(Br)cc43)cc2)CC1 |
| InChI | InChI=1S/C26H32BrN3O/c1-29-13-15-30(16-14-29)12-3-17-31-21-9-6-19(7-10-21)22-4-2-5-23-24-18-20(27)8-11-25(24)28-26(22)23/h6-11,18,22,28H,2-5,12-17H2,1H3 |
| InChIKey | WICITFXLPGOCRH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 31.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|