C22H28F3N5O2S — CID 11540301
N-heptyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide (PubChem CID 11540301) has the molecular formula C22H28F3N5O2S and a molecular weight of 483.56 g/mol. Its IUPAC name is N-heptyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | N-heptyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 11540301 |
| Molecular Formula | C22H28F3N5O2S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | N-heptyl-5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-1,3,4-thiadiazole-2-carboxamide |
| SMILES | CCCCCCCNC(=O)c1nnc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)s1 |
| InChI | InChI=1S/C22H28F3N5O2S/c1-2-3-4-5-8-11-26-18(31)19-27-28-21(33-19)30-14-12-29(13-15-30)20(32)16-9-6-7-10-17(16)22(23,24)25/h6-7,9-10H,2-5,8,11-15H2,1H3,(H,26,31) |
| InChIKey | ZLIURZHLSRLSNU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|