C11H11N3 — CID 115403477
3,7,9-triazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene (PubChem CID 115403477) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 3,7,9-triazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene.
| Compound Name | 3,7,9-triazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 115403477 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 3,7,9-triazatetracyclo[9.2.1.02,10.03,8]tetradeca-2(10),4,6,8-tetraene |
| SMILES | c1cnc2nc3c(n2c1)C1CCC3C1 |
| InChI | InChI=1S/C11H11N3/c1-4-12-11-13-9-7-2-3-8(6-7)10(9)14(11)5-1/h1,4-5,7-8H,2-3,6H2 |
| InChIKey | CIIFCTUEHZQSNA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |