C12H14BrN3 — CID 115403656
12-bromo-4,13-dimethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 115403656) has the molecular formula C12H14BrN3 and a molecular weight of 280.17 g/mol. Its IUPAC name is 12-bromo-4,13-dimethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 12-bromo-4,13-dimethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 115403656 |
| Molecular Formula | C12H14BrN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 12-bromo-4,13-dimethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | Cc1c(Br)ccc2nc3c(n12)CN(C)CC3 |
| InChI | InChI=1S/C12H14BrN3/c1-8-9(13)3-4-12-14-10-5-6-15(2)7-11(10)16(8)12/h3-4H,5-7H2,1-2H3 |
| InChIKey | JYZMRXYADGIMMC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |