C12H14ClN3 — CID 115403880
12-chloro-4-ethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 115403880) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is 12-chloro-4-ethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | 12-chloro-4-ethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 115403880 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | 12-chloro-4-ethyl-1,4,8-triazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | CCN1CCc2nc3ccc(Cl)cn3c2C1 |
| InChI | InChI=1S/C12H14ClN3/c1-2-15-6-5-10-11(8-15)16-7-9(13)3-4-12(16)14-10/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | ANUVOCYNYHMNAY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |