About 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine
5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine (PubChem CID 115404138) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine |
| PubChem CID | 115404138 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine |
| SMILES | COc1cc(OC)n2cc(-c3ccccc3C)nc2n1 |
| InChI | InChI=1S/C15H15N3O2/c1-10-6-4-5-7-11(10)12-9-18-14(20-3)8-13(19-2)17-15(18)16-12/h4-9H,1-3H3 |
| InChIKey | ANLJXTCUESXTFN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine?
The IUPAC name of 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine (CID 115404138) is 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine.
What is the SMILES notation for 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine?
The canonical SMILES for 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine is COc1cc(OC)n2cc(-c3ccccc3C)nc2n1.
What is the InChIKey of 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine?
The InChIKey is ANLJXTCUESXTFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-10-6-4-5-7-11(10)12-9-18-14(20-3)8-13(19-2)17-15(18)16-12/h4-9H,1-3H3.
What are the key properties of 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine?
5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine has a molecular weight of 269.30 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethoxy-2-(2-methylphenyl)imidazo[1,2-a]pyrimidine is sourced from PubChem (CID 115404138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).