C11H12BrN3 — CID 115404655
11-bromo-5,5-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 115404655) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 11-bromo-5,5-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-bromo-5,5-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 115404655 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 11-bromo-5,5-dimethyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | CC1(C)CCc2c1nc1ncc(Br)cn21 |
| InChI | InChI=1S/C11H12BrN3/c1-11(2)4-3-8-9(11)14-10-13-5-7(12)6-15(8)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | XPMPYZKTNWBAPP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |