C25H32N6O3S — CID 11540543
1-[3-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 11540543) has the molecular formula C25H32N6O3S and a molecular weight of 496.64 g/mol. Its IUPAC name is 1-[3-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 11540543 |
| Molecular Formula | C25H32N6O3S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 1-[3-[(4,4-dimethyl-8-morpholin-4-yl-5-oxa-11-thia-9,14,16-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),8,12(17),13,15-hexaen-13-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | CC1(C)Cc2c(c(N3CCOCC3)nc3sc4c(NCCCN5CCCC5=O)ncnc4c23)CO1 |
| InChI | InChI=1S/C25H32N6O3S/c1-25(2)13-16-17(14-34-25)23(31-9-11-33-12-10-31)29-24-19(16)20-21(35-24)22(28-15-27-20)26-6-4-8-30-7-3-5-18(30)32/h15H,3-14H2,1-2H3,(H,26,27,28) |
| InChIKey | QIGVVAYHJGPHCC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|