About 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine
5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine (PubChem CID 115405451) has the molecular formula C9H16F2N4
and a molecular weight of 218.25 g/mol. Its IUPAC name is 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine |
| PubChem CID | 115405451 |
| Molecular Formula | C9H16F2N4 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine |
| SMILES | CCCc1nn(C)c(NCC(F)F)c1N |
| InChI | InChI=1S/C9H16F2N4/c1-3-4-6-8(12)9(15(2)14-6)13-5-7(10)11/h7,13H,3-5,12H2,1-2H3 |
| InChIKey | GABQFQCBVWQPPQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine?
The IUPAC name of 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine (CID 115405451) is 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine.
What is the SMILES notation for 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine?
The canonical SMILES for 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine is CCCc1nn(C)c(NCC(F)F)c1N.
What is the InChIKey of 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine?
The InChIKey is GABQFQCBVWQPPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N4/c1-3-4-6-8(12)9(15(2)14-6)13-5-7(10)11/h7,13H,3-5,12H2,1-2H3.
What are the key properties of 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine?
5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine has a molecular weight of 218.25 g/mol, XLogP of 1.63, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2,2-difluoroethyl)-1-methyl-3-propylpyrazole-4,5-diamine is sourced from PubChem (CID 115405451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).