About 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine
5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine (PubChem CID 115405464) has the molecular formula C8H14F2N4
and a molecular weight of 204.22 g/mol. Its IUPAC name is 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine |
| PubChem CID | 115405464 |
| Molecular Formula | C8H14F2N4 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine |
| SMILES | CCn1nc(C)c(N)c1NCC(F)F |
| InChI | InChI=1S/C8H14F2N4/c1-3-14-8(12-4-6(9)10)7(11)5(2)13-14/h6,12H,3-4,11H2,1-2H3 |
| InChIKey | BFENJTLQYOCDHU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine?
The IUPAC name of 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine (CID 115405464) is 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine.
What is the SMILES notation for 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine?
The canonical SMILES for 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine is CCn1nc(C)c(N)c1NCC(F)F.
What is the InChIKey of 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine?
The InChIKey is BFENJTLQYOCDHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N4/c1-3-14-8(12-4-6(9)10)7(11)5(2)13-14/h6,12H,3-4,11H2,1-2H3.
What are the key properties of 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine?
5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine has a molecular weight of 204.22 g/mol, XLogP of 1.47, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(2,2-difluoroethyl)-1-ethyl-3-methylpyrazole-4,5-diamine is sourced from PubChem (CID 115405464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).