About ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate
ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate (PubChem CID 115405551) has the molecular formula C8H11F2N3O4S
and a molecular weight of 283.26 g/mol. Its IUPAC name is ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate |
| PubChem CID | 115405551 |
| Molecular Formula | C8H11F2N3O4S |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C8H11F2N3O4S/c1-2-17-8(14)5-3-11-13-7(5)18(15,16)12-4-6(9)10/h3,6,12H,2,4H2,1H3,(H,11,13) |
| InChIKey | HGZLUFDKXINIAE-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate (CID 115405551) is ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate is CCOC(=O)c1cn[nH]c1S(=O)(=O)NCC(F)F.
What is the InChIKey of ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate?
The InChIKey is HGZLUFDKXINIAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3O4S/c1-2-17-8(14)5-3-11-13-7(5)18(15,16)12-4-6(9)10/h3,6,12H,2,4H2,1H3,(H,11,13).
What are the key properties of ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate?
ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate has a molecular weight of 283.26 g/mol, XLogP of 0.13, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2,2-difluoroethylsulfamoyl)-1H-pyrazole-4-carboxylate is sourced from PubChem (CID 115405551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).