About N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine (PubChem CID 115405573) has the molecular formula C9H13F2N3O2
and a molecular weight of 233.22 g/mol. Its IUPAC name is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine |
| PubChem CID | 115405573 |
| Molecular Formula | C9H13F2N3O2 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine |
| SMILES | COc1ncnc(OC)c1CNCC(F)F |
| InChI | InChI=1S/C9H13F2N3O2/c1-15-8-6(3-12-4-7(10)11)9(16-2)14-5-13-8/h5,7,12H,3-4H2,1-2H3 |
| InChIKey | KLOXQPLKMRZVER-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine?
The IUPAC name of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine (CID 115405573) is N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine.
What is the SMILES notation for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine?
The canonical SMILES for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine is COc1ncnc(OC)c1CNCC(F)F.
What is the InChIKey of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine?
The InChIKey is KLOXQPLKMRZVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O2/c1-15-8-6(3-12-4-7(10)11)9(16-2)14-5-13-8/h5,7,12H,3-4H2,1-2H3.
What are the key properties of N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine?
N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine has a molecular weight of 233.22 g/mol, XLogP of 0.85, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,6-dimethoxypyrimidin-5-yl)methyl]-2,2-difluoroethanamine is sourced from PubChem (CID 115405573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).