About 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine
4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine (PubChem CID 115405621) has the molecular formula C12H23F2N
and a molecular weight of 219.32 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine |
| PubChem CID | 115405621 |
| Molecular Formula | C12H23F2N |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine |
| SMILES | CC(C)(C)C1CCC(NCC(F)F)CC1 |
| InChI | InChI=1S/C12H23F2N/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h9-11,15H,4-8H2,1-3H3 |
| InChIKey | VCAXGDYOQKRXSB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine?
The IUPAC name of 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine (CID 115405621) is 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine.
What is the SMILES notation for 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine?
The canonical SMILES for 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine is CC(C)(C)C1CCC(NCC(F)F)CC1.
What is the InChIKey of 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine?
The InChIKey is VCAXGDYOQKRXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F2N/c1-12(2,3)9-4-6-10(7-5-9)15-8-11(13)14/h9-11,15H,4-8H2,1-3H3.
What are the key properties of 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine?
4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine has a molecular weight of 219.32 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(2,2-difluoroethyl)cyclohexan-1-amine is sourced from PubChem (CID 115405621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).