About N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide
N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide (PubChem CID 115405702) has the molecular formula C9H12F2N2OS
and a molecular weight of 234.27 g/mol. Its IUPAC name is N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide |
| PubChem CID | 115405702 |
| Molecular Formula | C9H12F2N2OS |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNCC(F)F |
| InChI | InChI=1S/C9H12F2N2OS/c1-6(14)13-7-2-3-15-8(7)4-12-5-9(10)11/h2-3,9,12H,4-5H2,1H3,(H,13,14) |
| InChIKey | SYMJARFXFFBPJT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide?
The IUPAC name of N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide (CID 115405702) is N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide.
What is the SMILES notation for N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide?
The canonical SMILES for N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide is CC(=O)Nc1ccsc1CNCC(F)F.
What is the InChIKey of N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide?
The InChIKey is SYMJARFXFFBPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2OS/c1-6(14)13-7-2-3-15-8(7)4-12-5-9(10)11/h2-3,9,12H,4-5H2,1H3,(H,13,14).
What are the key properties of N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide?
N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide has a molecular weight of 234.27 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(2,2-difluoroethylamino)methyl]thiophen-3-yl]acetamide is sourced from PubChem (CID 115405702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).