About 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol
3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol (PubChem CID 115405788) has the molecular formula C8H14F2N4O
and a molecular weight of 220.22 g/mol. Its IUPAC name is 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol |
| PubChem CID | 115405788 |
| Molecular Formula | C8H14F2N4O |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol |
| SMILES | OCCCn1cc(CNCC(F)F)nn1 |
| InChI | InChI=1S/C8H14F2N4O/c9-8(10)5-11-4-7-6-14(13-12-7)2-1-3-15/h6,8,11,15H,1-5H2 |
| InChIKey | XCLRVECHLUBIOR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol?
The IUPAC name of 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol (CID 115405788) is 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol.
What is the SMILES notation for 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol?
The canonical SMILES for 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol is OCCCn1cc(CNCC(F)F)nn1.
What is the InChIKey of 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol?
The InChIKey is XCLRVECHLUBIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N4O/c9-8(10)5-11-4-7-6-14(13-12-7)2-1-3-15/h6,8,11,15H,1-5H2.
What are the key properties of 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol?
3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol has a molecular weight of 220.22 g/mol, XLogP of 0.02, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(2,2-difluoroethylamino)methyl]triazol-1-yl]propan-1-ol is sourced from PubChem (CID 115405788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).