About 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine
1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine (PubChem CID 115406071) has the molecular formula C8H16F2N2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine |
| PubChem CID | 115406071 |
| Molecular Formula | C8H16F2N2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine |
| SMILES | NC1CCCC(NCC(F)F)C1 |
| InChI | InChI=1S/C8H16F2N2/c9-8(10)5-12-7-3-1-2-6(11)4-7/h6-8,12H,1-5,11H2 |
| InChIKey | KTSMGTGKVSNMFP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine?
The IUPAC name of 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine (CID 115406071) is 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine.
What is the SMILES notation for 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine?
The canonical SMILES for 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine is NC1CCCC(NCC(F)F)C1.
What is the InChIKey of 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine?
The InChIKey is KTSMGTGKVSNMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2/c9-8(10)5-12-7-3-1-2-6(11)4-7/h6-8,12H,1-5,11H2.
What are the key properties of 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine?
1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine has a molecular weight of 178.23 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(2,2-difluoroethyl)cyclohexane-1,3-diamine is sourced from PubChem (CID 115406071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).