C13H20F2N2 — CID 115406341
2-N-(2,2-difluoroethyl)-4-phenylpentane-1,2-diamine (PubChem CID 115406341) has the molecular formula C13H20F2N2 and a molecular weight of 242.31 g/mol. Its IUPAC name is 2-N-(2,2-difluoroethyl)-4-phenylpentane-1,2-diamine.
| Compound Name | 2-N-(2,2-difluoroethyl)-4-phenylpentane-1,2-diamine |
|---|---|
| PubChem CID | 115406341 |
| Molecular Formula | C13H20F2N2 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-N-(2,2-difluoroethyl)-4-phenylpentane-1,2-diamine |
| SMILES | CC(CC(CN)NCC(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H20F2N2/c1-10(11-5-3-2-4-6-11)7-12(8-16)17-9-13(14)15/h2-6,10,12-13,17H,7-9,16H2,1H3 |
| InChIKey | FVLQEGFGVBKZKY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |