C7H12F2N2O2 — CID 115406836
3-amino-N-(2,2-difluoroethyl)oxolane-3-carboxamide (PubChem CID 115406836) has the molecular formula C7H12F2N2O2 and a molecular weight of 194.18 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoroethyl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(2,2-difluoroethyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 115406836 |
| Molecular Formula | C7H12F2N2O2 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-amino-N-(2,2-difluoroethyl)oxolane-3-carboxamide |
| SMILES | NC1(C(=O)NCC(F)F)CCOC1 |
| InChI | InChI=1S/C7H12F2N2O2/c8-5(9)3-11-6(12)7(10)1-2-13-4-7/h5H,1-4,10H2,(H,11,12) |
| InChIKey | YCLHJENKRSHUTB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |