C8H14F2N2O2 — CID 115406853
5-(aminomethyl)-N-(2,2-difluoroethyl)oxolane-2-carboxamide (PubChem CID 115406853) has the molecular formula C8H14F2N2O2 and a molecular weight of 208.21 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2,2-difluoroethyl)oxolane-2-carboxamide.
| Compound Name | 5-(aminomethyl)-N-(2,2-difluoroethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 115406853 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-(aminomethyl)-N-(2,2-difluoroethyl)oxolane-2-carboxamide |
| SMILES | NCC1CCC(C(=O)NCC(F)F)O1 |
| InChI | InChI=1S/C8H14F2N2O2/c9-7(10)4-12-8(13)6-2-1-5(3-11)14-6/h5-7H,1-4,11H2,(H,12,13) |
| InChIKey | CGQNQGPEAOXKQS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |