About 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide
4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide (PubChem CID 115406859) has the molecular formula C8H14F2N2O2
and a molecular weight of 208.21 g/mol. Its IUPAC name is 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide |
| PubChem CID | 115406859 |
| Molecular Formula | C8H14F2N2O2 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide |
| SMILES | NC1(C(=O)NCC(F)F)CCOCC1 |
| InChI | InChI=1S/C8H14F2N2O2/c9-6(10)5-12-7(13)8(11)1-3-14-4-2-8/h6H,1-5,11H2,(H,12,13) |
| InChIKey | UPPQIDANLHNZDO-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide?
The IUPAC name of 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide (CID 115406859) is 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide.
What is the SMILES notation for 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide?
The canonical SMILES for 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide is NC1(C(=O)NCC(F)F)CCOCC1.
What is the InChIKey of 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide?
The InChIKey is UPPQIDANLHNZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F2N2O2/c9-6(10)5-12-7(13)8(11)1-3-14-4-2-8/h6H,1-5,11H2,(H,12,13).
What are the key properties of 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide?
4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide has a molecular weight of 208.21 g/mol, XLogP of -0.12, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-(2,2-difluoroethyl)oxane-4-carboxamide is sourced from PubChem (CID 115406859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).