C11H20F2N2O — CID 115406882
N-(2,2-difluoroethyl)-3-propylpiperidine-3-carboxamide (PubChem CID 115406882) has the molecular formula C11H20F2N2O and a molecular weight of 234.29 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-3-propylpiperidine-3-carboxamide.
| Compound Name | N-(2,2-difluoroethyl)-3-propylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 115406882 |
| Molecular Formula | C11H20F2N2O |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N-(2,2-difluoroethyl)-3-propylpiperidine-3-carboxamide |
| SMILES | CCCC1(C(=O)NCC(F)F)CCCNC1 |
| InChI | InChI=1S/C11H20F2N2O/c1-2-4-11(5-3-6-14-8-11)10(16)15-7-9(12)13/h9,14H,2-8H2,1H3,(H,15,16) |
| InChIKey | SAWBJYXNNCPFRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |