C6H9F2N3 — CID 115407117
2,2-difluoro-N-(1H-pyrazol-4-ylmethyl)ethanamine (PubChem CID 115407117) has the molecular formula C6H9F2N3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2,2-difluoro-N-(1H-pyrazol-4-ylmethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(1H-pyrazol-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115407117 |
| Molecular Formula | C6H9F2N3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2,2-difluoro-N-(1H-pyrazol-4-ylmethyl)ethanamine |
| SMILES | FC(F)CNCc1cn[nH]c1 |
| InChI | InChI=1S/C6H9F2N3/c7-6(8)4-9-1-5-2-10-11-3-5/h2-3,6,9H,1,4H2,(H,10,11) |
| InChIKey | ORUFWQFGKJPNRR-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |