About 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide
1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide (PubChem CID 115407184) has the molecular formula C8H12F2N2OS
and a molecular weight of 222.26 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide |
| PubChem CID | 115407184 |
| Molecular Formula | C8H12F2N2OS |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide |
| SMILES | NC(=S)C1(C(=O)NCC(F)F)CCC1 |
| InChI | InChI=1S/C8H12F2N2OS/c9-5(10)4-12-7(13)8(6(11)14)2-1-3-8/h5H,1-4H2,(H2,11,14)(H,12,13) |
| InChIKey | XQCVKYAGQXLWEM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide?
The IUPAC name of 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide (CID 115407184) is 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide is NC(=S)C1(C(=O)NCC(F)F)CCC1.
What is the InChIKey of 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide?
The InChIKey is XQCVKYAGQXLWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2OS/c9-5(10)4-12-7(13)8(6(11)14)2-1-3-8/h5H,1-4H2,(H2,11,14)(H,12,13).
What are the key properties of 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide?
1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide has a molecular weight of 222.26 g/mol, XLogP of 0.82, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamothioyl-N-(2,2-difluoroethyl)cyclobutane-1-carboxamide is sourced from PubChem (CID 115407184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).