C25H21FN4O3S2 — CID 11540724
7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-N,N-dimethylthieno[3,2-b]pyridine-2-carboxamide (PubChem CID 11540724) has the molecular formula C25H21FN4O3S2 and a molecular weight of 508.60 g/mol. Its IUPAC name is 7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-N,N-dimethylthieno[3,2-b]pyridine-2-carboxamide.
| Compound Name | 7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-N,N-dimethylthieno[3,2-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 11540724 |
| Molecular Formula | C25H21FN4O3S2 |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 7-[2-fluoro-4-[(2-phenylacetyl)carbamothioylamino]phenoxy]-N,N-dimethylthieno[3,2-b]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1cc2nccc(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3F)c2s1 |
| InChI | InChI=1S/C25H21FN4O3S2/c1-30(2)24(32)21-14-18-23(35-21)20(10-11-27-18)33-19-9-8-16(13-17(19)26)28-25(34)29-22(31)12-15-6-4-3-5-7-15/h3-11,13-14H,12H2,1-2H3,(H2,28,29,31,34) |
| InChIKey | FVIIFUOCWXBFMO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|