C11H20F2N2 — CID 115407364
N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-2,2-difluoroethanamine (PubChem CID 115407364) has the molecular formula C11H20F2N2 and a molecular weight of 218.29 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-2,2-difluoroethanamine.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115407364 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-ylmethyl)-2,2-difluoroethanamine |
| SMILES | FC(F)CNCC1CC2CCCCC2N1 |
| InChI | InChI=1S/C11H20F2N2/c12-11(13)7-14-6-9-5-8-3-1-2-4-10(8)15-9/h8-11,14-15H,1-7H2 |
| InChIKey | UQZOZWBEMXCCMT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |