C24H25F2N9O2 — CID 11540737
1-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-2,5-difluorophenyl]ethanol (PubChem CID 11540737) has the molecular formula C24H25F2N9O2 and a molecular weight of 509.52 g/mol. Its IUPAC name is 1-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-2,5-difluorophenyl]ethanol.
| Compound Name | 1-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-2,5-difluorophenyl]ethanol |
|---|---|
| PubChem CID | 11540737 |
| Molecular Formula | C24H25F2N9O2 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 1-[4-[4-[2-[7-amino-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]ethyl]piperazin-1-yl]-2,5-difluorophenyl]ethanol |
| SMILES | CC(O)c1cc(F)c(N2CCN(CCn3ncc4c3nc(N)n3nc(-c5ccco5)nc43)CC2)cc1F |
| InChI | InChI=1S/C24H25F2N9O2/c1-14(36)15-11-18(26)19(12-17(15)25)33-7-4-32(5-8-33)6-9-34-22-16(13-28-34)23-29-21(20-3-2-10-37-20)31-35(23)24(27)30-22/h2-3,10-14,36H,4-9H2,1H3,(H2,27,30) |
| InChIKey | DZEWKWBCGQGUEA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|