About N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine
N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine (PubChem CID 115407517) has the molecular formula C6H14F2N2
and a molecular weight of 152.19 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine |
| PubChem CID | 115407517 |
| Molecular Formula | C6H14F2N2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine |
| SMILES | CC(CN)CNCC(F)F |
| InChI | InChI=1S/C6H14F2N2/c1-5(2-9)3-10-4-6(7)8/h5-6,10H,2-4,9H2,1H3 |
| InChIKey | MFYKYJLWSDNBKT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine?
The IUPAC name of N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine (CID 115407517) is N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine.
What is the SMILES notation for N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine?
The canonical SMILES for N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine is CC(CN)CNCC(F)F.
What is the InChIKey of N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine?
The InChIKey is MFYKYJLWSDNBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14F2N2/c1-5(2-9)3-10-4-6(7)8/h5-6,10H,2-4,9H2,1H3.
What are the key properties of N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine?
N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine has a molecular weight of 152.19 g/mol, XLogP of 0.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-2-methylpropane-1,3-diamine is sourced from PubChem (CID 115407517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).