C4H5F2N3S — CID 115407570
N-(2,2-difluoroethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 115407570) has the molecular formula C4H5F2N3S and a molecular weight of 165.17 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(2,2-difluoroethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 115407570 |
| Molecular Formula | C4H5F2N3S |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | N-(2,2-difluoroethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | FC(F)CNc1nncs1 |
| InChI | InChI=1S/C4H5F2N3S/c5-3(6)1-7-4-9-8-2-10-4/h2-3H,1H2,(H,7,9) |
| InChIKey | VJVPNCHKAPVHCU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |