C10H9F2N3 — CID 115407622
N-(2,2-difluoroethyl)phthalazin-1-amine (PubChem CID 115407622) has the molecular formula C10H9F2N3 and a molecular weight of 209.20 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)phthalazin-1-amine.
| Compound Name | N-(2,2-difluoroethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 115407622 |
| Molecular Formula | C10H9F2N3 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | N-(2,2-difluoroethyl)phthalazin-1-amine |
| SMILES | FC(F)CNc1nncc2ccccc12 |
| InChI | InChI=1S/C10H9F2N3/c11-9(12)6-13-10-8-4-2-1-3-7(8)5-14-15-10/h1-5,9H,6H2,(H,13,15) |
| InChIKey | UWFQLBSPMOAWCY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |