About 1-amino-3-(2,2-difluoroethyl)thiourea
1-amino-3-(2,2-difluoroethyl)thiourea (PubChem CID 115407686) has the molecular formula C3H7F2N3S
and a molecular weight of 155.17 g/mol. Its IUPAC name is 1-amino-3-(2,2-difluoroethyl)thiourea.
Molecular Properties
| Compound Name | 1-amino-3-(2,2-difluoroethyl)thiourea |
| PubChem CID | 115407686 |
| Molecular Formula | C3H7F2N3S |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 1-amino-3-(2,2-difluoroethyl)thiourea |
| SMILES | NNC(=S)NCC(F)F |
| InChI | InChI=1S/C3H7F2N3S/c4-2(5)1-7-3(9)8-6/h2H,1,6H2,(H2,7,8,9) |
| InChIKey | CVRHOFNBSZIYSQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-3-(2,2-difluoroethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(2,2-difluoroethyl)thiourea?
The IUPAC name of 1-amino-3-(2,2-difluoroethyl)thiourea (CID 115407686) is 1-amino-3-(2,2-difluoroethyl)thiourea.
What is the SMILES notation for 1-amino-3-(2,2-difluoroethyl)thiourea?
The canonical SMILES for 1-amino-3-(2,2-difluoroethyl)thiourea is NNC(=S)NCC(F)F.
What is the InChIKey of 1-amino-3-(2,2-difluoroethyl)thiourea?
The InChIKey is CVRHOFNBSZIYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7F2N3S/c4-2(5)1-7-3(9)8-6/h2H,1,6H2,(H2,7,8,9).
What are the key properties of 1-amino-3-(2,2-difluoroethyl)thiourea?
1-amino-3-(2,2-difluoroethyl)thiourea has a molecular weight of 155.17 g/mol, XLogP of -0.41, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(2,2-difluoroethyl)thiourea is sourced from PubChem (CID 115407686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).