C9H9F2N3S — CID 115407756
3-(2,2-difluoroethyl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 115407756) has the molecular formula C9H9F2N3S and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 3-(2,2-difluoroethyl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 115407756 |
| Molecular Formula | C9H9F2N3S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 3-(2,2-difluoroethyl)-7-methyl-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1ccnc2c1[nH]c(=S)n2CC(F)F |
| InChI | InChI=1S/C9H9F2N3S/c1-5-2-3-12-8-7(5)13-9(15)14(8)4-6(10)11/h2-3,6H,4H2,1H3,(H,13,15) |
| InChIKey | ATZTXXDLYMVDKL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|