2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid

C11H11ClF2N2O3 — CID 115408035

IUPAC2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid
SMILESO=C(O)CN(C(=O)NCC(F)F)c1ccc(Cl)cc1
InChIInChI=1S/C11H11ClF2N2O3/c12-7-1-3-8(4-2-7)16(6-10(17)18)11(19)15-5-9(13)14/h1-4,9H,5-6H2,(H,15,19)(H,17,18)
InChIKeyAWNBMXMPBMJFAE-UHFFFAOYSA-N
MW292.67 g/mol
LogP2.21
Rot. Bonds5

About 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid

2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid (PubChem CID 115408035) has the molecular formula C11H11ClF2N2O3 and a molecular weight of 292.67 g/mol. Its IUPAC name is 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid.

Molecular Properties

Compound Name2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid
PubChem CID115408035
Molecular FormulaC11H11ClF2N2O3
Molecular Weight292.67 g/mol
Exact Mass292.04
IUPAC Name2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid
SMILESO=C(O)CN(C(=O)NCC(F)F)c1ccc(Cl)cc1
InChIInChI=1S/C11H11ClF2N2O3/c12-7-1-3-8(4-2-7)16(6-10(17)18)11(19)15-5-9(13)14/h1-4,9H,5-6H2,(H,15,19)(H,17,18)
InChIKeyAWNBMXMPBMJFAE-UHFFFAOYSA-N
XLogP2.21
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.67
LogP ≤ 52.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid?
The IUPAC name of 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid (CID 115408035) is 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid.
What is the SMILES notation for 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid?
The canonical SMILES for 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid is O=C(O)CN(C(=O)NCC(F)F)c1ccc(Cl)cc1.
What is the InChIKey of 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid?
The InChIKey is AWNBMXMPBMJFAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2N2O3/c12-7-1-3-8(4-2-7)16(6-10(17)18)11(19)15-5-9(13)14/h1-4,9H,5-6H2,(H,15,19)(H,17,18).
What are the key properties of 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid?
2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid has a molecular weight of 292.67 g/mol, XLogP of 2.21, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-N-(2,2-difluoroethylcarbamoyl)anilino]acetic acid is sourced from PubChem (CID 115408035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).