C6H8F2N2S — CID 115408215
3-(2,2-difluoroethyl)-4-methyl-1H-imidazole-2-thione (PubChem CID 115408215) has the molecular formula C6H8F2N2S and a molecular weight of 178.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(2,2-difluoroethyl)-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 115408215 |
| Molecular Formula | C6H8F2N2S |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-(2,2-difluoroethyl)-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CC(F)F |
| InChI | InChI=1S/C6H8F2N2S/c1-4-2-9-6(11)10(4)3-5(7)8/h2,5H,3H2,1H3,(H,9,11) |
| InChIKey | KHLPEXKANSUUPC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|