About N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide
N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (PubChem CID 115408308) has the molecular formula C6H8F2N2O3S2
and a molecular weight of 258.27 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| PubChem CID | 115408308 |
| Molecular Formula | C6H8F2N2O3S2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1[nH]c(=O)sc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C6H8F2N2O3S2/c1-3-5(14-6(11)10-3)15(12,13)9-2-4(7)8/h4,9H,2H2,1H3,(H,10,11) |
| InChIKey | IJXBXWVCUXNUPH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide (CID 115408308) is N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is Cc1[nH]c(=O)sc1S(=O)(=O)NCC(F)F.
What is the InChIKey of N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
The InChIKey is IJXBXWVCUXNUPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2O3S2/c1-3-5(14-6(11)10-3)15(12,13)9-2-4(7)8/h4,9H,2H2,1H3,(H,10,11).
What are the key properties of N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide?
N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide has a molecular weight of 258.27 g/mol, XLogP of 0.29, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-difluoroethyl)-4-methyl-2-oxo-3H-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 115408308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).