About 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid
5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 115408798) has the molecular formula C6H6F2N2O2S
and a molecular weight of 208.19 g/mol. Its IUPAC name is 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 115408798 |
| Molecular Formula | C6H6F2N2O2S |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1ncsc1NCC(F)F |
| InChI | InChI=1S/C6H6F2N2O2S/c7-3(8)1-9-5-4(6(11)12)10-2-13-5/h2-3,9H,1H2,(H,11,12) |
| InChIKey | PDZQGLXOHYMNHJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid (CID 115408798) is 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid is O=C(O)c1ncsc1NCC(F)F.
What is the InChIKey of 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is PDZQGLXOHYMNHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F2N2O2S/c7-3(8)1-9-5-4(6(11)12)10-2-13-5/h2-3,9H,1H2,(H,11,12).
What are the key properties of 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid?
5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 208.19 g/mol, XLogP of 1.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 115408798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).