About 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione
3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 115409368) has the molecular formula C6H8F2N2OS
and a molecular weight of 194.21 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
| PubChem CID | 115409368 |
| Molecular Formula | C6H8F2N2OS |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1CC(F)F |
| InChI | InChI=1S/C6H8F2N2OS/c7-5(8)2-10-4(3-11)1-9-6(10)12/h1,5,11H,2-3H2,(H,9,12) |
| InChIKey | ZCZMHNAHTAIKCV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 40.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione?
The IUPAC name of 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione (CID 115409368) is 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione.
What is the SMILES notation for 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione?
The canonical SMILES for 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione is OCc1c[nH]c(=S)n1CC(F)F.
What is the InChIKey of 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione?
The InChIKey is ZCZMHNAHTAIKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2OS/c7-5(8)2-10-4(3-11)1-9-6(10)12/h1,5,11H,2-3H2,(H,9,12).
What are the key properties of 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione?
3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione has a molecular weight of 194.21 g/mol, XLogP of 1.30, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione is sourced from PubChem (CID 115409368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).