C6H8F2N2O — CID 115409377
[3-(2,2-difluoroethyl)imidazol-4-yl]methanol (PubChem CID 115409377) has the molecular formula C6H8F2N2O and a molecular weight of 162.14 g/mol. Its IUPAC name is [3-(2,2-difluoroethyl)imidazol-4-yl]methanol.
| Compound Name | [3-(2,2-difluoroethyl)imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 115409377 |
| Molecular Formula | C6H8F2N2O |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | [3-(2,2-difluoroethyl)imidazol-4-yl]methanol |
| SMILES | OCc1cncn1CC(F)F |
| InChI | InChI=1S/C6H8F2N2O/c7-6(8)2-10-4-9-1-5(10)3-11/h1,4,6,11H,2-3H2 |
| InChIKey | KMOMVAOYAQPOHF-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |