About 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine
3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 115409379) has the molecular formula C4H7F2N5
and a molecular weight of 163.13 g/mol. Its IUPAC name is 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine.
Analyze 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine?
The IUPAC name of 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine (CID 115409379) is 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine.
What is the SMILES notation for 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine?
The canonical SMILES for 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine is Nc1nc(NCC(F)F)n[nH]1.
What is the InChIKey of 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine?
The InChIKey is LSTNHVLNOWOCIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F2N5/c5-2(6)1-8-4-9-3(7)10-11-4/h2H,1H2,(H4,7,8,9,10,11).
What are the key properties of 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine?
3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine has a molecular weight of 163.13 g/mol, XLogP of 0.06, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2,2-difluoroethyl)-1H-1,2,4-triazole-3,5-diamine is sourced from PubChem (CID 115409379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).