About [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol
[4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol (PubChem CID 115409594) has the molecular formula C5H7F2N3O
and a molecular weight of 163.13 g/mol. Its IUPAC name is [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol.
Molecular Properties
| Compound Name | [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol |
| PubChem CID | 115409594 |
| Molecular Formula | C5H7F2N3O |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol |
| SMILES | OCc1nncn1CC(F)F |
| InChI | InChI=1S/C5H7F2N3O/c6-4(7)1-10-3-8-9-5(10)2-11/h3-4,11H,1-2H2 |
| InChIKey | UZJFKAGHHDJJOD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
The IUPAC name of [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol (CID 115409594) is [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol.
What is the SMILES notation for [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
The canonical SMILES for [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol is OCc1nncn1CC(F)F.
What is the InChIKey of [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
The InChIKey is UZJFKAGHHDJJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N3O/c6-4(7)1-10-3-8-9-5(10)2-11/h3-4,11H,1-2H2.
What are the key properties of [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol?
[4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol has a molecular weight of 163.13 g/mol, XLogP of 0.04, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-difluoroethyl)-1,2,4-triazol-3-yl]methanol is sourced from PubChem (CID 115409594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).